C24H25N3O2S — CID 9407484
(2R)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide (PubChem CID 9407484) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is (2R)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide.
| Compound Name | (2R)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
|---|---|
| PubChem CID | 9407484 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (2R)-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)N[C@@H]2CCCc3ccccc32)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H25N3O2S/c1-3-15-27-23(29)19-12-6-7-13-21(19)26-24(27)30-16(2)22(28)25-20-14-8-10-17-9-4-5-11-18(17)20/h3-7,9,11-13,16,20H,1,8,10,14-15H2,2H3,(H,25,28)/t16-,20-/m1/s1 |
| InChIKey | IFJRQIVQWUMAJV-OXQOHEQNSA-N |
| XLogP | 4.26 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|