C23H22ClN3O2S — CID 4819183
2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 4819183) has the molecular formula C23H22ClN3O2S and a molecular weight of 439.97 g/mol. Its IUPAC name is 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 4819183 |
| Molecular Formula | C23H22ClN3O2S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NC2CCCc3ccccc32)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C23H22ClN3O2S/c1-2-12-27-22(29)18-13-16(24)10-11-20(18)26-23(27)30-14-21(28)25-19-9-5-7-15-6-3-4-8-17(15)19/h2-4,6,8,10-11,13,19H,1,5,7,9,12,14H2,(H,25,28) |
| InChIKey | LUIFHXPGBXVCCJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|