C20H24ClN3O2S — CID 2488009
6-chloro-2-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one (PubChem CID 2488009) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is 6-chloro-2-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one.
| Compound Name | 6-chloro-2-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 2488009 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 6-chloro-2-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCC(=O)N2[C@H](C)CCC[C@H]2C)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C20H24ClN3O2S/c1-4-10-23-19(26)16-11-15(21)8-9-17(16)22-20(23)27-12-18(25)24-13(2)6-5-7-14(24)3/h4,8-9,11,13-14H,1,5-7,10,12H2,2-3H3/t13-,14-/m1/s1 |
| InChIKey | WEKYZGAUXSOZQZ-ZIAGYGMSSA-N |
| XLogP | 4.12 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|