C16H17ClN2O3S — CID 7691774
6-chloro-2-[[(4S)-1,3-dioxan-4-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one (PubChem CID 7691774) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is 6-chloro-2-[[(4S)-1,3-dioxan-4-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one.
| Compound Name | 6-chloro-2-[[(4S)-1,3-dioxan-4-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 7691774 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 6-chloro-2-[[(4S)-1,3-dioxan-4-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SC[C@@H]2CCOCO2)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C16H17ClN2O3S/c1-2-6-19-15(20)13-8-11(17)3-4-14(13)18-16(19)23-9-12-5-7-21-10-22-12/h2-4,8,12H,1,5-7,9-10H2/t12-/m0/s1 |
| InChIKey | MNFQPVLXFIUKOU-LBPRGKRZSA-N |
| XLogP | 3.09 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|