C24H29N3O2S — CID 11925648
(2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(3-methyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide (PubChem CID 11925648) has the molecular formula C24H29N3O2S and a molecular weight of 423.58 g/mol. Its IUPAC name is (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(3-methyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(3-methyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 11925648 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-(3-methyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@@H](C)Sc1nc2cc3ccccc3cc2c(=O)n1C |
| InChI | InChI=1S/C24H29N3O2S/c1-14-8-7-11-20(15(14)2)25-22(28)16(3)30-24-26-21-13-18-10-6-5-9-17(18)12-19(21)23(29)27(24)4/h5-6,9-10,12-16,20H,7-8,11H2,1-4H3,(H,25,28)/t14-,15-,16-,20+/m1/s1 |
| InChIKey | FMVNAVWKWCQKLW-NLDJYOPPSA-N |
| XLogP | 4.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|