C15H18N4O3S2 — CID 40880461
(2R)-N-(ethylcarbamoyl)-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylpropanamide (PubChem CID 40880461) has the molecular formula C15H18N4O3S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (2R)-N-(ethylcarbamoyl)-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-(ethylcarbamoyl)-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 40880461 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2R)-N-(ethylcarbamoyl)-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)NC(=O)NCC)nc2ccsc2c1=O |
| InChI | InChI=1S/C15H18N4O3S2/c1-4-7-19-13(21)11-10(6-8-23-11)17-15(19)24-9(3)12(20)18-14(22)16-5-2/h4,6,8-9H,1,5,7H2,2-3H3,(H2,16,18,20,22)/t9-/m1/s1 |
| InChIKey | OLFPJGCNJYBMTP-SECBINFHSA-N |
| XLogP | 1.97 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|