C17H17N3O2S3 — CID 40879916
(2R)-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 40879916) has the molecular formula C17H17N3O2S3 and a molecular weight of 391.54 g/mol. Its IUPAC name is (2R)-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | (2R)-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 40879916 |
| Molecular Formula | C17H17N3O2S3 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (2R)-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)NCc2cccs2)nc2ccsc2c1=O |
| InChI | InChI=1S/C17H17N3O2S3/c1-3-7-20-16(22)14-13(6-9-24-14)19-17(20)25-11(2)15(21)18-10-12-5-4-8-23-12/h3-6,8-9,11H,1,7,10H2,2H3,(H,18,21)/t11-/m1/s1 |
| InChIKey | CMMCCIRYOZIIKF-LLVKDONJSA-N |
| XLogP | 3.50 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|