C23H26N4OS — CID 7251160
N-(4-piperidin-1-ylphenyl)-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 7251160) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7251160 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(N3CCCCC3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C23H26N4OS/c1-2-14-27-21-9-5-4-8-20(21)25-23(27)29-17-22(28)24-18-10-12-19(13-11-18)26-15-6-3-7-16-26/h2,4-5,8-13H,1,3,6-7,14-17H2,(H,24,28) |
| InChIKey | HNEBFSCOQDMFKI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|