C16H18ClN3O4S2 — CID 46693870
2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]acetamide (PubChem CID 46693870) has the molecular formula C16H18ClN3O4S2 and a molecular weight of 415.92 g/mol. Its IUPAC name is 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]acetamide.
| Compound Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 46693870 |
| Molecular Formula | C16H18ClN3O4S2 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[3-(dimethylsulfamoyl)-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(=O)CSc2ncccc2Cl)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H18ClN3O4S2/c1-20(2)26(22,23)14-9-11(6-7-13(14)24-3)19-15(21)10-25-16-12(17)5-4-8-18-16/h4-9H,10H2,1-3H3,(H,19,21) |
| InChIKey | MABDWPHUXKLERK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |