C14H11FN2O3S — CID 1174565
2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid (PubChem CID 1174565) has the molecular formula C14H11FN2O3S and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 1174565 |
| Molecular Formula | C14H11FN2O3S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[2-(2-fluoroanilino)-2-oxoethyl]sulfanylpyridine-3-carboxylic acid |
| SMILES | O=C(CSc1ncccc1C(=O)O)Nc1ccccc1F |
| InChI | InChI=1S/C14H11FN2O3S/c15-10-5-1-2-6-11(10)17-12(18)8-21-13-9(14(19)20)4-3-7-16-13/h1-7H,8H2,(H,17,18)(H,19,20) |
| InChIKey | ZFVIJRCPOUIGEM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |