C18H14F2N2OS — CID 87033616
N-(2-fluorophenyl)-2-[(5-fluoroquinolin-8-yl)methylsulfanyl]acetamide (PubChem CID 87033616) has the molecular formula C18H14F2N2OS and a molecular weight of 344.39 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(5-fluoroquinolin-8-yl)methylsulfanyl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(5-fluoroquinolin-8-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 87033616 |
| Molecular Formula | C18H14F2N2OS |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(5-fluoroquinolin-8-yl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1ccc(F)c2cccnc12)Nc1ccccc1F |
| InChI | InChI=1S/C18H14F2N2OS/c19-14-8-7-12(18-13(14)4-3-9-21-18)10-24-11-17(23)22-16-6-2-1-5-15(16)20/h1-9H,10-11H2,(H,22,23) |
| InChIKey | GCRCCGOXZDQLRW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |