C16H12ClF4NOS — CID 100501688
2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 100501688) has the molecular formula C16H12ClF4NOS and a molecular weight of 377.79 g/mol. Its IUPAC name is 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 100501688 |
| Molecular Formula | C16H12ClF4NOS |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 2-[(4-chloro-2-fluorophenyl)methylsulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSCc1ccc(Cl)cc1F)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12ClF4NOS/c17-11-6-5-10(13(18)7-11)8-24-9-15(23)22-14-4-2-1-3-12(14)16(19,20)21/h1-7H,8-9H2,(H,22,23) |
| InChIKey | NUBYWQVOKJKZNZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |