C15H12BrFN2O4S — CID 118972809
2-[2-[2-bromo-5-(fluoromethoxy)anilino]-2-oxoethyl]sulfanylpyridine-3-carboxylic acid (PubChem CID 118972809) has the molecular formula C15H12BrFN2O4S and a molecular weight of 415.24 g/mol. Its IUPAC name is 2-[2-[2-bromo-5-(fluoromethoxy)anilino]-2-oxoethyl]sulfanylpyridine-3-carboxylic acid.
| Compound Name | 2-[2-[2-bromo-5-(fluoromethoxy)anilino]-2-oxoethyl]sulfanylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118972809 |
| Molecular Formula | C15H12BrFN2O4S |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | 2-[2-[2-bromo-5-(fluoromethoxy)anilino]-2-oxoethyl]sulfanylpyridine-3-carboxylic acid |
| SMILES | O=C(CSc1ncccc1C(=O)O)Nc1cc(OCF)ccc1Br |
| InChI | InChI=1S/C15H12BrFN2O4S/c16-11-4-3-9(23-8-17)6-12(11)19-13(20)7-24-14-10(15(21)22)2-1-5-18-14/h1-6H,7-8H2,(H,19,20)(H,21,22) |
| InChIKey | PUUVCGOTTZJQQA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |