C15H13BrClN3O2S — CID 55496429
N-(2-bromophenyl)-2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]amino]acetamide (PubChem CID 55496429) has the molecular formula C15H13BrClN3O2S and a molecular weight of 414.71 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]amino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 55496429 |
| Molecular Formula | C15H13BrClN3O2S |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | N-(2-bromophenyl)-2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]amino]acetamide |
| SMILES | O=C(CSc1ncccc1Cl)NCC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C15H13BrClN3O2S/c16-10-4-1-2-6-12(10)20-13(21)8-19-14(22)9-23-15-11(17)5-3-7-18-15/h1-7H,8-9H2,(H,19,22)(H,20,21) |
| InChIKey | PFEDGFBJSFQTRF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |