C15H15ClN2OS2 — CID 134012279
3-[(3-chloro-2-pyridinyl)sulfanyl]-N-(2-methylsulfanylphenyl)propanamide (PubChem CID 134012279) has the molecular formula C15H15ClN2OS2 and a molecular weight of 338.89 g/mol. Its IUPAC name is 3-[(3-chloro-2-pyridinyl)sulfanyl]-N-(2-methylsulfanylphenyl)propanamide.
| Compound Name | 3-[(3-chloro-2-pyridinyl)sulfanyl]-N-(2-methylsulfanylphenyl)propanamide |
|---|---|
| PubChem CID | 134012279 |
| Molecular Formula | C15H15ClN2OS2 |
| Molecular Weight | 338.89 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 3-[(3-chloro-2-pyridinyl)sulfanyl]-N-(2-methylsulfanylphenyl)propanamide |
| SMILES | CSc1ccccc1NC(=O)CCSc1ncccc1Cl |
| InChI | InChI=1S/C15H15ClN2OS2/c1-20-13-7-3-2-6-12(13)18-14(19)8-10-21-15-11(16)5-4-9-17-15/h2-7,9H,8,10H2,1H3,(H,18,19) |
| InChIKey | ORHIXLQZTSMAQI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |