C17H14Cl2N4OS — CID 55496936
N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-2-[(3-chloro-2-pyridinyl)sulfanyl]acetamide (PubChem CID 55496936) has the molecular formula C17H14Cl2N4OS and a molecular weight of 393.30 g/mol. Its IUPAC name is N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-2-[(3-chloro-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-2-[(3-chloro-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 55496936 |
| Molecular Formula | C17H14Cl2N4OS |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-[2-[(2-chlorophenyl)methyl]pyrazol-3-yl]-2-[(3-chloro-2-pyridinyl)sulfanyl]acetamide |
| SMILES | O=C(CSc1ncccc1Cl)Nc1ccnn1Cc1ccccc1Cl |
| InChI | InChI=1S/C17H14Cl2N4OS/c18-13-5-2-1-4-12(13)10-23-15(7-9-21-23)22-16(24)11-25-17-14(19)6-3-8-20-17/h1-9H,10-11H2,(H,22,24) |
| InChIKey | NEZMRKWBHODICE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |