C11H17ClN2S — CID 64631084
4-[(3-chloro-2-pyridinyl)sulfanyl]-N-ethylbutan-2-amine (PubChem CID 64631084) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is 4-[(3-chloro-2-pyridinyl)sulfanyl]-N-ethylbutan-2-amine.
| Compound Name | 4-[(3-chloro-2-pyridinyl)sulfanyl]-N-ethylbutan-2-amine |
|---|---|
| PubChem CID | 64631084 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-[(3-chloro-2-pyridinyl)sulfanyl]-N-ethylbutan-2-amine |
| SMILES | CCNC(C)CCSc1ncccc1Cl |
| InChI | InChI=1S/C11H17ClN2S/c1-3-13-9(2)6-8-15-11-10(12)5-4-7-14-11/h4-5,7,9,13H,3,6,8H2,1-2H3 |
| InChIKey | RLDIDHGHLITROF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |