C9H13ClN2OS — CID 64821551
2-amino-4-[(3-chloro-2-pyridinyl)sulfanyl]butan-1-ol (PubChem CID 64821551) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 2-amino-4-[(3-chloro-2-pyridinyl)sulfanyl]butan-1-ol.
| Compound Name | 2-amino-4-[(3-chloro-2-pyridinyl)sulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 64821551 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-amino-4-[(3-chloro-2-pyridinyl)sulfanyl]butan-1-ol |
| SMILES | NC(CO)CCSc1ncccc1Cl |
| InChI | InChI=1S/C9H13ClN2OS/c10-8-2-1-4-12-9(8)14-5-3-7(11)6-13/h1-2,4,7,13H,3,5-6,11H2 |
| InChIKey | VJUKMQKSIQUJND-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |