C22H23ClFN3O2S — CID 2089296
2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-(3-morpholin-4-ylpropyl)quinazolin-4-one (PubChem CID 2089296) has the molecular formula C22H23ClFN3O2S and a molecular weight of 447.96 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-(3-morpholin-4-ylpropyl)quinazolin-4-one.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-(3-morpholin-4-ylpropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2089296 |
| Molecular Formula | C22H23ClFN3O2S |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-(3-morpholin-4-ylpropyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2ccc(F)cc2Cl)n1CCCN1CCOCC1 |
| InChI | InChI=1S/C22H23ClFN3O2S/c23-19-14-17(24)7-6-16(19)15-30-22-25-20-5-2-1-4-18(20)21(28)27(22)9-3-8-26-10-12-29-13-11-26/h1-2,4-7,14H,3,8-13,15H2 |
| InChIKey | CIFMSJRDMICBPG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |