C24H23FN2O3S — CID 5054564
7-[2-(cyclohexen-1-yl)ethyl]-6-[(4-fluorophenyl)methylsulfanyl]-[1,3]dioxolo[4,5-g]quinazolin-8-one (PubChem CID 5054564) has the molecular formula C24H23FN2O3S and a molecular weight of 438.52 g/mol. Its IUPAC name is 7-[2-(cyclohexen-1-yl)ethyl]-6-[(4-fluorophenyl)methylsulfanyl]-[1,3]dioxolo[4,5-g]quinazolin-8-one.
| Compound Name | 7-[2-(cyclohexen-1-yl)ethyl]-6-[(4-fluorophenyl)methylsulfanyl]-[1,3]dioxolo[4,5-g]quinazolin-8-one |
|---|---|
| PubChem CID | 5054564 |
| Molecular Formula | C24H23FN2O3S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 7-[2-(cyclohexen-1-yl)ethyl]-6-[(4-fluorophenyl)methylsulfanyl]-[1,3]dioxolo[4,5-g]quinazolin-8-one |
| SMILES | O=c1c2cc3c(cc2nc(SCc2ccc(F)cc2)n1CCC1=CCCCC1)OCO3 |
| InChI | InChI=1S/C24H23FN2O3S/c25-18-8-6-17(7-9-18)14-31-24-26-20-13-22-21(29-15-30-22)12-19(20)23(28)27(24)11-10-16-4-2-1-3-5-16/h4,6-9,12-13H,1-3,5,10-11,14-15H2 |
| InChIKey | LZKHRUQRNHTUKF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|