C21H20FN3O2 — CID 109151123
4-N-(2-cyanophenyl)-1-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109151123) has the molecular formula C21H20FN3O2 and a molecular weight of 365.41 g/mol. Its IUPAC name is 4-N-(2-cyanophenyl)-1-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(2-cyanophenyl)-1-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109151123 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-N-(2-cyanophenyl)-1-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | N#Cc1ccccc1NC(=O)C1CCC(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H20FN3O2/c22-17-5-3-6-18(12-17)24-20(26)14-8-10-15(11-9-14)21(27)25-19-7-2-1-4-16(19)13-23/h1-7,12,14-15H,8-11H2,(H,24,26)(H,25,27) |
| InChIKey | LAWUIJQNOBXNIA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |