C20H26ClN4O3S+ — CID 2125109
N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 2125109) has the molecular formula C20H26ClN4O3S+ and a molecular weight of 437.97 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2125109 |
| Molecular Formula | C20H26ClN4O3S+ |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2cc(Cl)ccc2N2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C20H25ClN4O3S/c1-23(2)29(27,28)17-7-4-15(5-8-17)20(26)22-18-14-16(21)6-9-19(18)25-12-10-24(3)11-13-25/h4-9,14H,10-13H2,1-3H3,(H,22,26)/p+1 |
| InChIKey | XOPQAODAANUBHA-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |