C22H30Cl2N3O+ — CID 7775022
(5S,7R)-3-chloro-N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]adamantane-1-carboxamide (PubChem CID 7775022) has the molecular formula C22H30Cl2N3O+ and a molecular weight of 423.41 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7775022 |
| Molecular Formula | C22H30Cl2N3O+ |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (5S,7R)-3-chloro-N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]adamantane-1-carboxamide |
| SMILES | C[NH+]1CCN(c2ccc(Cl)cc2NC(=O)C23C[C@@H]4C[C@@H](CC(Cl)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C22H29Cl2N3O/c1-26-4-6-27(7-5-26)19-3-2-17(23)9-18(19)25-20(28)21-10-15-8-16(11-21)13-22(24,12-15)14-21/h2-3,9,15-16H,4-8,10-14H2,1H3,(H,25,28)/p+1/t15-,16+,21?,22? |
| InChIKey | JCFKDKSBZRFALD-MBWAJUJLSA-O |
| XLogP | 3.19 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|