C24H31N7O3S — CID 55390515
N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 55390515) has the molecular formula C24H31N7O3S and a molecular weight of 497.63 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 55390515 |
| Molecular Formula | C24H31N7O3S |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-piperidin-1-ylphenyl]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCCC2)c(NC(=O)Cn2nnc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H31N7O3S/c1-3-30(4-2)35(33,34)20-13-14-22(29-15-9-6-10-16-29)21(17-20)25-23(32)18-31-27-24(26-28-31)19-11-7-5-8-12-19/h5,7-8,11-14,17H,3-4,6,9-10,15-16,18H2,1-2H3,(H,25,32) |
| InChIKey | LLDSKMJXGDJVIA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |