C23H25F3N4O2 — CID 1065396
1-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 1065396) has the molecular formula C23H25F3N4O2 and a molecular weight of 446.47 g/mol. Its IUPAC name is 1-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 1065396 |
| Molecular Formula | C23H25F3N4O2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-[3-(pyrrolidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccc(N2CCCC2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C23H25F3N4O2/c24-23(25,26)16-6-5-7-17(14-16)27-22(32)28-18-8-9-20(29-10-1-2-11-29)19(15-18)21(31)30-12-3-4-13-30/h5-9,14-15H,1-4,10-13H2,(H2,27,28,32) |
| InChIKey | RJTUJOHGPBUOPX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|