C27H30F6N4O2 — CID 5205098
1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]urea (PubChem CID 5205098) has the molecular formula C27H30F6N4O2 and a molecular weight of 556.55 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]urea |
|---|---|
| PubChem CID | 5205098 |
| Molecular Formula | C27H30F6N4O2 |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[3-(4-methylpiperidine-1-carbonyl)-4-piperidin-1-ylphenyl]urea |
| SMILES | CC1CCN(C(=O)c2cc(NC(=O)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2N2CCCCC2)CC1 |
| InChI | InChI=1S/C27H30F6N4O2/c1-17-7-11-37(12-8-17)24(38)22-16-20(5-6-23(22)36-9-3-2-4-10-36)34-25(39)35-21-14-18(26(28,29)30)13-19(15-21)27(31,32)33/h5-6,13-17H,2-4,7-12H2,1H3,(H2,34,35,39) |
| InChIKey | YWZIMQAAVBPNER-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|