C19H23BrFN3OS — CID 60589999
1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea (PubChem CID 60589999) has the molecular formula C19H23BrFN3OS and a molecular weight of 440.38 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea.
| Compound Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 60589999 |
| Molecular Formula | C19H23BrFN3OS |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)urea |
| SMILES | O=C(NCCc1cc(Br)ccc1F)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C19H23BrFN3OS/c20-15-5-6-16(21)14(12-15)7-8-22-19(25)23-13-17(18-4-3-11-26-18)24-9-1-2-10-24/h3-6,11-12,17H,1-2,7-10,13H2,(H2,22,23,25) |
| InChIKey | XQNSMBWVYJHMSB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |