C15H18FN5O2 — CID 94179653
1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea (PubChem CID 94179653) has the molecular formula C15H18FN5O2 and a molecular weight of 319.34 g/mol. Its IUPAC name is 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea.
| Compound Name | 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
|---|---|
| PubChem CID | 94179653 |
| Molecular Formula | C15H18FN5O2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-[(2S)-2-(4-fluorophenyl)-2-hydroxyethyl]-3-[2-(pyrimidin-2-ylamino)ethyl]urea |
| SMILES | O=C(NCCNc1ncccn1)NC[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FN5O2/c16-12-4-2-11(3-5-12)13(22)10-21-15(23)20-9-8-19-14-17-6-1-7-18-14/h1-7,13,22H,8-10H2,(H,17,18,19)(H2,20,21,23)/t13-/m1/s1 |
| InChIKey | NCQLGMQOYSIQJC-CYBMUJFWSA-N |
| XLogP | 1.06 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|