C19H14F5N5O — CID 133352853
2,6-difluoro-N-[2-[[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 133352853) has the molecular formula C19H14F5N5O and a molecular weight of 423.35 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-[[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[2-[[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 133352853 |
| Molecular Formula | C19H14F5N5O |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2,6-difluoro-N-[2-[[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNc1cc(C(F)(F)F)nc(-c2ccncc2)n1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H14F5N5O/c20-12-2-1-3-13(21)16(12)18(30)27-9-8-26-15-10-14(19(22,23)24)28-17(29-15)11-4-6-25-7-5-11/h1-7,10H,8-9H2,(H,27,30)(H,26,28,29) |
| InChIKey | RBZWSQQUWCJSRJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|