C13H14ClFN4O — CID 121177198
3-(3-chloro-4-fluorophenyl)-N-[2-(triazol-2-yl)ethyl]propanamide (PubChem CID 121177198) has the molecular formula C13H14ClFN4O and a molecular weight of 296.73 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-N-[2-(triazol-2-yl)ethyl]propanamide.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-N-[2-(triazol-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 121177198 |
| Molecular Formula | C13H14ClFN4O |
| Molecular Weight | 296.73 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-N-[2-(triazol-2-yl)ethyl]propanamide |
| SMILES | O=C(CCc1ccc(F)c(Cl)c1)NCCn1nccn1 |
| InChI | InChI=1S/C13H14ClFN4O/c14-11-9-10(1-3-12(11)15)2-4-13(20)16-7-8-19-17-5-6-18-19/h1,3,5-6,9H,2,4,7-8H2,(H,16,20) |
| InChIKey | ZRUJRNUZVOFAER-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |