C23H20ClN7O — CID 122317050
1-(3-chlorophenyl)-3-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]urea (PubChem CID 122317050) has the molecular formula C23H20ClN7O and a molecular weight of 445.91 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 122317050 |
| Molecular Formula | C23H20ClN7O |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]urea |
| SMILES | Cc1nc(Nc2ccc(NC(=O)Nc3cccc(Cl)c3)cc2)cc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C23H20ClN7O/c1-15-26-21(14-22(27-15)31-20-7-2-3-12-25-20)28-17-8-10-18(11-9-17)29-23(32)30-19-6-4-5-16(24)13-19/h2-14H,1H3,(H2,29,30,32)(H2,25,26,27,28,31) |
| InChIKey | RJKFQUJEEJBJKM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |