C21H18N6OS — CID 122317137
N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]thiophene-3-carboxamide (PubChem CID 122317137) has the molecular formula C21H18N6OS and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 122317137 |
| Molecular Formula | C21H18N6OS |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-[4-[[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]thiophene-3-carboxamide |
| SMILES | Cc1nc(Nc2ccc(NC(=O)c3ccsc3)cc2)cc(Nc2ccccn2)n1 |
| InChI | InChI=1S/C21H18N6OS/c1-14-23-19(12-20(24-14)27-18-4-2-3-10-22-18)25-16-5-7-17(8-6-16)26-21(28)15-9-11-29-13-15/h2-13H,1H3,(H,26,28)(H2,22,23,24,25,27) |
| InChIKey | ACVYJLSDODNPQC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |