C15H17N7OS — CID 122328518
1-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-thiophen-2-ylurea (PubChem CID 122328518) has the molecular formula C15H17N7OS and a molecular weight of 343.42 g/mol. Its IUPAC name is 1-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-thiophen-2-ylurea.
| Compound Name | 1-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 122328518 |
| Molecular Formula | C15H17N7OS |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]-3-thiophen-2-ylurea |
| SMILES | Cc1ccn(-c2cc(NCCNC(=O)Nc3cccs3)ncn2)n1 |
| InChI | InChI=1S/C15H17N7OS/c1-11-4-7-22(21-11)13-9-12(18-10-19-13)16-5-6-17-15(23)20-14-3-2-8-24-14/h2-4,7-10H,5-6H2,1H3,(H,16,18,19)(H2,17,20,23) |
| InChIKey | MUABVTDFICUQEU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|