C16H19BrN6O2S2 — CID 122290263
5-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide (PubChem CID 122290263) has the molecular formula C16H19BrN6O2S2 and a molecular weight of 471.41 g/mol. Its IUPAC name is 5-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 122290263 |
| Molecular Formula | C16H19BrN6O2S2 |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | 5-bromo-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(C)n(-c2cc(NCCNS(=O)(=O)c3ccc(Br)s3)nc(C)n2)n1 |
| InChI | InChI=1S/C16H19BrN6O2S2/c1-10-8-11(2)23(22-10)15-9-14(20-12(3)21-15)18-6-7-19-27(24,25)16-5-4-13(17)26-16/h4-5,8-9,19H,6-7H2,1-3H3,(H,18,20,21) |
| InChIKey | KWAMCPAAQIPVLK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|