C21H23N5O5 — CID 122321528
8-methoxy-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-2-oxochromene-3-carboxamide (PubChem CID 122321528) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is 8-methoxy-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | 8-methoxy-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 122321528 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 8-methoxy-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)NCCNc3cc(N4CCOCC4)cnn3)c(=O)oc12 |
| InChI | InChI=1S/C21H23N5O5/c1-29-17-4-2-3-14-11-16(21(28)31-19(14)17)20(27)23-6-5-22-18-12-15(13-24-25-18)26-7-9-30-10-8-26/h2-4,11-13H,5-10H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | QECUBOOLSBNQGH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 118.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|