C14H13Cl2N — CID 63952494
N-[2-(2,5-dichlorophenyl)ethyl]aniline (PubChem CID 63952494) has the molecular formula C14H13Cl2N and a molecular weight of 266.17 g/mol. Its IUPAC name is N-[2-(2,5-dichlorophenyl)ethyl]aniline.
| Compound Name | N-[2-(2,5-dichlorophenyl)ethyl]aniline |
|---|---|
| PubChem CID | 63952494 |
| Molecular Formula | C14H13Cl2N |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | N-[2-(2,5-dichlorophenyl)ethyl]aniline |
| SMILES | Clc1ccc(Cl)c(CCNc2ccccc2)c1 |
| InChI | InChI=1S/C14H13Cl2N/c15-12-6-7-14(16)11(10-12)8-9-17-13-4-2-1-3-5-13/h1-7,10,17H,8-9H2 |
| InChIKey | KWXHVEVZEMIEDZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |