C15H20Cl2N6 — CID 166326818
6-N-[2-(2,5-dichlorophenyl)ethyl]-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 166326818) has the molecular formula C15H20Cl2N6 and a molecular weight of 355.27 g/mol. Its IUPAC name is 6-N-[2-(2,5-dichlorophenyl)ethyl]-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-(2,5-dichlorophenyl)ethyl]-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 166326818 |
| Molecular Formula | C15H20Cl2N6 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 6-N-[2-(2,5-dichlorophenyl)ethyl]-2-N,2-N,4-N,4-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(NCCc2cc(Cl)ccc2Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C15H20Cl2N6/c1-22(2)14-19-13(20-15(21-14)23(3)4)18-8-7-10-9-11(16)5-6-12(10)17/h5-6,9H,7-8H2,1-4H3,(H,18,19,20,21) |
| InChIKey | QLSCGGZVODKGFM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |