C16H19Cl2N3O2S — CID 113015866
N-[6-[2-(2,4-dichlorophenyl)ethylamino]-3-pyridinyl]propane-1-sulfonamide (PubChem CID 113015866) has the molecular formula C16H19Cl2N3O2S and a molecular weight of 388.32 g/mol. Its IUPAC name is N-[6-[2-(2,4-dichlorophenyl)ethylamino]-3-pyridinyl]propane-1-sulfonamide.
| Compound Name | N-[6-[2-(2,4-dichlorophenyl)ethylamino]-3-pyridinyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 113015866 |
| Molecular Formula | C16H19Cl2N3O2S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | N-[6-[2-(2,4-dichlorophenyl)ethylamino]-3-pyridinyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(NCCc2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C16H19Cl2N3O2S/c1-2-9-24(22,23)21-14-5-6-16(20-11-14)19-8-7-12-3-4-13(17)10-15(12)18/h3-6,10-11,21H,2,7-9H2,1H3,(H,19,20) |
| InChIKey | NXTUBHISOFXIAC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |