C15H17Cl2N3O2S — CID 113031073
N-[5-[2-(2,4-dichlorophenyl)ethylamino]-2-pyridinyl]ethanesulfonamide (PubChem CID 113031073) has the molecular formula C15H17Cl2N3O2S and a molecular weight of 374.29 g/mol. Its IUPAC name is N-[5-[2-(2,4-dichlorophenyl)ethylamino]-2-pyridinyl]ethanesulfonamide.
| Compound Name | N-[5-[2-(2,4-dichlorophenyl)ethylamino]-2-pyridinyl]ethanesulfonamide |
|---|---|
| PubChem CID | 113031073 |
| Molecular Formula | C15H17Cl2N3O2S |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-[5-[2-(2,4-dichlorophenyl)ethylamino]-2-pyridinyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NCCc2ccc(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C15H17Cl2N3O2S/c1-2-23(21,22)20-15-6-5-13(10-19-15)18-8-7-11-3-4-12(16)9-14(11)17/h3-6,9-10,18H,2,7-8H2,1H3,(H,19,20) |
| InChIKey | WNQAHFILIIDXJD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |