C18H15Cl2N3O2 — CID 113031062
N-[5-[2-(2,4-dichlorophenyl)ethylamino]-2-pyridinyl]furan-2-carboxamide (PubChem CID 113031062) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is N-[5-[2-(2,4-dichlorophenyl)ethylamino]-2-pyridinyl]furan-2-carboxamide.
| Compound Name | N-[5-[2-(2,4-dichlorophenyl)ethylamino]-2-pyridinyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 113031062 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[5-[2-(2,4-dichlorophenyl)ethylamino]-2-pyridinyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NCCc2ccc(Cl)cc2Cl)cn1)c1ccco1 |
| InChI | InChI=1S/C18H15Cl2N3O2/c19-13-4-3-12(15(20)10-13)7-8-21-14-5-6-17(22-11-14)23-18(24)16-2-1-9-25-16/h1-6,9-11,21H,7-8H2,(H,22,23,24) |
| InChIKey | GMFLUDBRVHRLAG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |