C15H18Cl2N2O — CID 68726093
2-cyano-N-[2-(2,4-dichlorophenyl)ethyl]-3,3-dimethylbutanamide (PubChem CID 68726093) has the molecular formula C15H18Cl2N2O and a molecular weight of 313.23 g/mol. Its IUPAC name is 2-cyano-N-[2-(2,4-dichlorophenyl)ethyl]-3,3-dimethylbutanamide.
| Compound Name | 2-cyano-N-[2-(2,4-dichlorophenyl)ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 68726093 |
| Molecular Formula | C15H18Cl2N2O |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-cyano-N-[2-(2,4-dichlorophenyl)ethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)C(C#N)C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl2N2O/c1-15(2,3)12(9-18)14(20)19-7-6-10-4-5-11(16)8-13(10)17/h4-5,8,12H,6-7H2,1-3H3,(H,19,20) |
| InChIKey | QHHJQTWULANNSA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |