C18H16Cl2N2O2 — CID 9246467
(2R)-2-(4-cyanophenoxy)-N-[2-(2,4-dichlorophenyl)ethyl]propanamide (PubChem CID 9246467) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is (2R)-2-(4-cyanophenoxy)-N-[2-(2,4-dichlorophenyl)ethyl]propanamide.
| Compound Name | (2R)-2-(4-cyanophenoxy)-N-[2-(2,4-dichlorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 9246467 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (2R)-2-(4-cyanophenoxy)-N-[2-(2,4-dichlorophenyl)ethyl]propanamide |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-12(24-16-6-2-13(11-21)3-7-16)18(23)22-9-8-14-4-5-15(19)10-17(14)20/h2-7,10,12H,8-9H2,1H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | OEXFEMUFYLRABE-GFCCVEGCSA-N |
| XLogP | 3.99 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |