C12H17Cl2N — CID 43370461
1-(2,4-dichlorophenyl)hexan-3-amine (PubChem CID 43370461) has the molecular formula C12H17Cl2N and a molecular weight of 246.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)hexan-3-amine.
| Compound Name | 1-(2,4-dichlorophenyl)hexan-3-amine |
|---|---|
| PubChem CID | 43370461 |
| Molecular Formula | C12H17Cl2N |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)hexan-3-amine |
| SMILES | CCCC(N)CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N/c1-2-3-11(15)7-5-9-4-6-10(13)8-12(9)14/h4,6,8,11H,2-3,5,7,15H2,1H3 |
| InChIKey | LZTXEBUWSIFHMS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |