C15H13BrCl2O — CID 60798840
1-(3-bromophenyl)-3-(2,4-dichlorophenyl)propan-2-ol (PubChem CID 60798840) has the molecular formula C15H13BrCl2O and a molecular weight of 360.08 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,4-dichlorophenyl)propan-2-ol.
| Compound Name | 1-(3-bromophenyl)-3-(2,4-dichlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 60798840 |
| Molecular Formula | C15H13BrCl2O |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,4-dichlorophenyl)propan-2-ol |
| SMILES | OC(Cc1cccc(Br)c1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13BrCl2O/c16-12-3-1-2-10(6-12)7-14(19)8-11-4-5-13(17)9-15(11)18/h1-6,9,14,19H,7-8H2 |
| InChIKey | MZPVAEJVIMZFFA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |