C14H23N5S — CID 105148326
N-[(4-tert-butylthiadiazol-5-yl)-(2-ethylpyrazol-3-yl)methyl]ethanamine (PubChem CID 105148326) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is N-[(4-tert-butylthiadiazol-5-yl)-(2-ethylpyrazol-3-yl)methyl]ethanamine.
| Compound Name | N-[(4-tert-butylthiadiazol-5-yl)-(2-ethylpyrazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105148326 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[(4-tert-butylthiadiazol-5-yl)-(2-ethylpyrazol-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1snnc1C(C)(C)C)c1ccnn1CC |
| InChI | InChI=1S/C14H23N5S/c1-6-15-11(10-8-9-16-19(10)7-2)12-13(14(3,4)5)17-18-20-12/h8-9,11,15H,6-7H2,1-5H3 |
| InChIKey | WRZNFFUERGYNSA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |