C13H10F5N3 — CID 115860519
N-[(2,3,4,5,6-pentafluorophenyl)-pyrazin-2-ylmethyl]ethanamine (PubChem CID 115860519) has the molecular formula C13H10F5N3 and a molecular weight of 303.23 g/mol. Its IUPAC name is N-[(2,3,4,5,6-pentafluorophenyl)-pyrazin-2-ylmethyl]ethanamine.
| Compound Name | N-[(2,3,4,5,6-pentafluorophenyl)-pyrazin-2-ylmethyl]ethanamine |
|---|---|
| PubChem CID | 115860519 |
| Molecular Formula | C13H10F5N3 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-[(2,3,4,5,6-pentafluorophenyl)-pyrazin-2-ylmethyl]ethanamine |
| SMILES | CCNC(c1cnccn1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H10F5N3/c1-2-20-13(6-5-19-3-4-21-6)7-8(14)10(16)12(18)11(17)9(7)15/h3-5,13,20H,2H2,1H3 |
| InChIKey | RXUCCBQVDNZTSH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|