C12H16F2O3S — CID 65095439
1-(3,5-difluorophenyl)-4-ethylsulfonylbutan-1-ol (PubChem CID 65095439) has the molecular formula C12H16F2O3S and a molecular weight of 278.32 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-4-ethylsulfonylbutan-1-ol.
| Compound Name | 1-(3,5-difluorophenyl)-4-ethylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 65095439 |
| Molecular Formula | C12H16F2O3S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-(3,5-difluorophenyl)-4-ethylsulfonylbutan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2O3S/c1-2-18(16,17)5-3-4-12(15)9-6-10(13)8-11(14)7-9/h6-8,12,15H,2-5H2,1H3 |
| InChIKey | XAXJQMZHRKGYRW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |