C13H19FO3S — CID 115803626
4-ethylsulfonyl-1-(2-fluoro-5-methylphenyl)butan-1-ol (PubChem CID 115803626) has the molecular formula C13H19FO3S and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-ethylsulfonyl-1-(2-fluoro-5-methylphenyl)butan-1-ol.
| Compound Name | 4-ethylsulfonyl-1-(2-fluoro-5-methylphenyl)butan-1-ol |
|---|---|
| PubChem CID | 115803626 |
| Molecular Formula | C13H19FO3S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-ethylsulfonyl-1-(2-fluoro-5-methylphenyl)butan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)c1cc(C)ccc1F |
| InChI | InChI=1S/C13H19FO3S/c1-3-18(16,17)8-4-5-13(15)11-9-10(2)6-7-12(11)14/h6-7,9,13,15H,3-5,8H2,1-2H3 |
| InChIKey | GAPSHYYNVJMDPQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |