C15H17FOS — CID 105094222
1-(2-fluoro-5-methylphenyl)-4-thiophen-2-ylbutan-1-ol (PubChem CID 105094222) has the molecular formula C15H17FOS and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(2-fluoro-5-methylphenyl)-4-thiophen-2-ylbutan-1-ol.
| Compound Name | 1-(2-fluoro-5-methylphenyl)-4-thiophen-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 105094222 |
| Molecular Formula | C15H17FOS |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-(2-fluoro-5-methylphenyl)-4-thiophen-2-ylbutan-1-ol |
| SMILES | Cc1ccc(F)c(C(O)CCCc2cccs2)c1 |
| InChI | InChI=1S/C15H17FOS/c1-11-7-8-14(16)13(10-11)15(17)6-2-4-12-5-3-9-18-12/h3,5,7-10,15,17H,2,4,6H2,1H3 |
| InChIKey | NEGXYTNPYMKKCJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |