C12H10F2OS — CID 62802428
1-(2,5-difluorophenyl)-2-thiophen-2-ylethanol (PubChem CID 62802428) has the molecular formula C12H10F2OS and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-thiophen-2-ylethanol.
| Compound Name | 1-(2,5-difluorophenyl)-2-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 62802428 |
| Molecular Formula | C12H10F2OS |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-thiophen-2-ylethanol |
| SMILES | OC(Cc1cccs1)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H10F2OS/c13-8-3-4-11(14)10(6-8)12(15)7-9-2-1-5-16-9/h1-6,12,15H,7H2 |
| InChIKey | NZLDEJVDTNGGSF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |